C18H16N2O5 — CID 57037509
dimethyl 4-(2-cyanophenyl)-6-formyl-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57037509) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is dimethyl 4-(2-cyanophenyl)-6-formyl-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(2-cyanophenyl)-6-formyl-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57037509 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | dimethyl 4-(2-cyanophenyl)-6-formyl-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C=O)N=C(C)C(C(=O)OC)C1c1ccccc1C#N |
| InChI | InChI=1S/C18H16N2O5/c1-10-14(17(22)24-2)15(12-7-5-4-6-11(12)8-19)16(18(23)25-3)13(9-21)20-10/h4-7,9,14-15H,1-3H3 |
| InChIKey | NXBCKZGQYMSYCZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 105.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|