C11H15BrN2 — CID 57037545
6-bromo-2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine (PubChem CID 57037545) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 6-bromo-2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine.
| Compound Name | 6-bromo-2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine |
|---|---|
| PubChem CID | 57037545 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 6-bromo-2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine |
| SMILES | [H]/N=C1\CC2CNC3C=CC(Br)C(C1)C23 |
| InChI | InChI=1S/C11H15BrN2/c12-9-1-2-10-11-6(5-14-10)3-7(13)4-8(9)11/h1-2,6,8-11,13-14H,3-5H2/b13-7+ |
| InChIKey | NSFFIILVDSRVGN-NTUHNPAUSA-N |
| XLogP | 1.95 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|