C11H16N2 — CID 57280024
2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine (PubChem CID 57280024) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine.
| Compound Name | 2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine |
|---|---|
| PubChem CID | 57280024 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,2a,3,5,5a,6,8a,9-octahydro-1H-benzo[cd]indol-4-imine |
| SMILES | [H]/N=C1/CC2CC=CC3NCC(C1)C23 |
| InChI | InChI=1S/C11H16N2/c12-9-4-7-2-1-3-10-11(7)8(5-9)6-13-10/h1,3,7-8,10-13H,2,4-6H2/b12-9- |
| InChIKey | WBQYDLJFZQVEBM-XFXZXTDPSA-N |
| XLogP | 1.58 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|