C30H43NO3 — CID 57038864
3-[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-2-oxo-1H-pyridine-4-carbaldehyde (PubChem CID 57038864) has the molecular formula C30H43NO3 and a molecular weight of 465.68 g/mol. Its IUPAC name is 3-[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-2-oxo-1H-pyridine-4-carbaldehyde.
| Compound Name | 3-[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-2-oxo-1H-pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 57038864 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | 3-[(4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-2-oxo-1H-pyridine-4-carbaldehyde |
| SMILES | C[C@H](CCC(=O)c1c(C=O)cc[nH]c1=O)[C@H]1CCC2C3CCC4CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H43NO3/c1-19(7-12-26(33)27-20(18-32)14-17-31-28(27)34)23-10-11-24-22-9-8-21-6-4-5-15-29(21,2)25(22)13-16-30(23,24)3/h14,17-19,21-25H,4-13,15-16H2,1-3H3,(H,31,34)/t19-,21?,22?,23-,24?,25?,29+,30-/m1/s1 |
| InChIKey | AFLWBNVYOONBFR-WVEYTROBSA-N |
| XLogP | 6.84 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|