4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid

C19H40O2Si2 — CID 57042489

IUPAC4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid
SMILESCC(=CC(CC[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O
InChIInChI=1S/C19H40O2Si2/c1-15(17(20)21)14-16(23(10,11)19(5,6)7)12-13-22(8,9)18(2,3)4/h14,16H,12-13H2,1-11H3,(H,20,21)
InChIKeyJIRMRUKTAPJETA-UHFFFAOYSA-N
MW356.70 g/mol
LogP6.79
Rot. Bonds6

About 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid

4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid (PubChem CID 57042489) has the molecular formula C19H40O2Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid.

Molecular Properties

Compound Name4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid
PubChem CID57042489
Molecular FormulaC19H40O2Si2
Molecular Weight356.70 g/mol
Exact Mass356.26
IUPAC Name4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid
SMILESCC(=CC(CC[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O
InChIInChI=1S/C19H40O2Si2/c1-15(17(20)21)14-16(23(10,11)19(5,6)7)12-13-22(8,9)18(2,3)4/h14,16H,12-13H2,1-11H3,(H,20,21)
InChIKeyJIRMRUKTAPJETA-UHFFFAOYSA-N
XLogP6.79
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500356.70
LogP ≤ 56.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid?
The IUPAC name of 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid (CID 57042489) is 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid.
What is the SMILES notation for 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid?
The canonical SMILES for 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid is CC(=CC(CC[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O.
What is the InChIKey of 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid?
The InChIKey is JIRMRUKTAPJETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O2Si2/c1-15(17(20)21)14-16(23(10,11)19(5,6)7)12-13-22(8,9)18(2,3)4/h14,16H,12-13H2,1-11H3,(H,20,21).
What are the key properties of 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid?
4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid has a molecular weight of 356.70 g/mol, XLogP of 6.79, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid is sourced from PubChem (CID 57042489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).