C19H40O2Si2 — CID 57042489
4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid (PubChem CID 57042489) has the molecular formula C19H40O2Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid.
| Compound Name | 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 57042489 |
| Molecular Formula | C19H40O2Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 4,6-bis[tert-butyl(dimethyl)silyl]-2-methylhex-2-enoic acid |
| SMILES | CC(=CC(CC[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H40O2Si2/c1-15(17(20)21)14-16(23(10,11)19(5,6)7)12-13-22(8,9)18(2,3)4/h14,16H,12-13H2,1-11H3,(H,20,21) |
| InChIKey | JIRMRUKTAPJETA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|