C10H19Cl3Si2 — CID 57043686
chloro-[2,2-dichloroethyl-bis(prop-2-enyl)silyl]-dimethylsilane (PubChem CID 57043686) has the molecular formula C10H19Cl3Si2 and a molecular weight of 301.79 g/mol. Its IUPAC name is chloro-[2,2-dichloroethyl-bis(prop-2-enyl)silyl]-dimethylsilane.
| Compound Name | chloro-[2,2-dichloroethyl-bis(prop-2-enyl)silyl]-dimethylsilane |
|---|---|
| PubChem CID | 57043686 |
| Molecular Formula | C10H19Cl3Si2 |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | chloro-[2,2-dichloroethyl-bis(prop-2-enyl)silyl]-dimethylsilane |
| SMILES | C=CC[Si](CC=C)(CC(Cl)Cl)[Si](C)(C)Cl |
| InChI | InChI=1S/C10H19Cl3Si2/c1-5-7-15(8-6-2,9-10(11)12)14(3,4)13/h5-6,10H,1-2,7-9H2,3-4H3 |
| InChIKey | HSFBXZOLHHYKDA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|