C6H13ClMgSi — CID 11194608
magnesium;methanidyl-dimethyl-prop-2-enylsilane;chloride (PubChem CID 11194608) has the molecular formula C6H13ClMgSi and a molecular weight of 173.01 g/mol. Its IUPAC name is magnesium;methanidyl-dimethyl-prop-2-enylsilane;chloride.
| Compound Name | magnesium;methanidyl-dimethyl-prop-2-enylsilane;chloride |
|---|---|
| PubChem CID | 11194608 |
| Molecular Formula | C6H13ClMgSi |
| Molecular Weight | 173.01 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | magnesium;methanidyl-dimethyl-prop-2-enylsilane;chloride |
| SMILES | C=CC[Si]([CH2-])(C)C.[Cl-].[Mg+2] |
| InChI | InChI=1S/C6H13Si.ClH.Mg/c1-5-6-7(2,3)4;;/h5H,1-2,6H2,3-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | FIUWEQJNBNLUNX-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.01 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|