C48H84Si5 — CID 11115445
tetrakis[3-tris(prop-2-enyl)silylpropyl]silane (PubChem CID 11115445) has the molecular formula C48H84Si5 and a molecular weight of 801.63 g/mol. Its IUPAC name is tetrakis[3-tris(prop-2-enyl)silylpropyl]silane.
| Compound Name | tetrakis[3-tris(prop-2-enyl)silylpropyl]silane |
|---|---|
| PubChem CID | 11115445 |
| Molecular Formula | C48H84Si5 |
| Molecular Weight | 801.63 g/mol |
| Exact Mass | 800.54 |
| IUPAC Name | tetrakis[3-tris(prop-2-enyl)silylpropyl]silane |
| SMILES | C=CC[Si](CC=C)(CC=C)CCC[Si](CCC[Si](CC=C)(CC=C)CC=C)(CCC[Si](CC=C)(CC=C)CC=C)CCC[Si](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C48H84Si5/c1-13-29-49(30-14-2,31-15-3)41-25-45-53(46-26-42-50(32-16-4,33-17-5)34-18-6,47-27-43-51(35-19-7,36-20-8)37-21-9)48-28-44-52(38-22-10,39-23-11)40-24-12/h13-24H,1-12,25-48H2 |
| InChIKey | AVVXLYQRJQLBCB-UHFFFAOYSA-N |
| XLogP | 17.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.63 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|