C23H39NO3 — CID 57046553
5,5,9,13-tetramethyl-7-[2-(oxiran-2-yl)ethyl]-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 57046553) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is 5,5,9,13-tetramethyl-7-[2-(oxiran-2-yl)ethyl]-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | 5,5,9,13-tetramethyl-7-[2-(oxiran-2-yl)ethyl]-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 57046553 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | 5,5,9,13-tetramethyl-7-[2-(oxiran-2-yl)ethyl]-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CCCNC(=O)CCC(C)(C)C(=O)C(CCC2CO2)CC(C)CCC1 |
| InChI | InChI=1S/C23H39NO3/c1-17-7-5-8-18(2)15-19(10-11-20-16-27-20)22(26)23(3,4)13-12-21(25)24-14-6-9-17/h9,18-20H,5-8,10-16H2,1-4H3,(H,24,25) |
| InChIKey | HKWGBSNITVSYMS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|