C20H35NO3 — CID 144859918
(13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 144859918) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 144859918 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (13Z)-4-hydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/CCNC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)CCC1 |
| InChI | InChI=1S/C20H35NO3/c1-14-8-6-9-15(2)12-16(3)19(24)20(4,5)17(22)13-18(23)21-11-7-10-14/h10,15-17,22H,6-9,11-13H2,1-5H3,(H,21,23)/b14-10- |
| InChIKey | YWFRSPPPRSGVCX-UVTDQMKNSA-N |
| XLogP | 3.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|