C24H41NO5 — CID 18343642
3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 18343642) has the molecular formula C24H41NO5 and a molecular weight of 423.59 g/mol. Its IUPAC name is 3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 18343642 |
| Molecular Formula | C24H41NO5 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C=C(\C)C1CC2OC2(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)N1 |
| InChI | InChI=1S/C24H41NO5/c1-8-14(2)17-12-19-24(7,30-19)11-9-10-15(3)21(28)16(4)22(29)23(5,6)18(26)13-20(27)25-17/h8,15-19,21,26,28H,9-13H2,1-7H3,(H,25,27)/b14-8+ |
| InChIKey | VNQSCFCDSWTWRF-RIYZIHGNSA-N |
| XLogP | 3.15 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|