C24H43NO6 — CID 18343627
11-[3-[(E)-2-amino-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid (PubChem CID 18343627) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is 11-[3-[(E)-2-amino-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid.
| Compound Name | 11-[3-[(E)-2-amino-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
|---|---|
| PubChem CID | 18343627 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 11-[3-[(E)-2-amino-3-methylpent-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
| SMILES | C/C=C(\C)C(N)CC1OC1(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O |
| InChI | InChI=1S/C24H43NO6/c1-8-14(2)17(25)12-19-24(7,31-19)11-9-10-15(3)21(29)16(4)22(30)23(5,6)18(26)13-20(27)28/h8,15-19,21,26,29H,9-13,25H2,1-7H3,(H,27,28)/b14-8+ |
| InChIKey | MFLYYOIEXHGONX-RIYZIHGNSA-N |
| XLogP | 3.06 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|