C28H44N2O5S — CID 91054717
(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[4-(2-methyl-4H-1,3-thiazol-5-ylidene)but-2-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91054717) has the molecular formula C28H44N2O5S and a molecular weight of 520.74 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[4-(2-methyl-4H-1,3-thiazol-5-ylidene)but-2-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[4-(2-methyl-4H-1,3-thiazol-5-ylidene)but-2-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91054717 |
| Molecular Formula | C28H44N2O5S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[4-(2-methyl-4H-1,3-thiazol-5-ylidene)but-2-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=CC=C1CN=C(C)S1)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1 |
| InChI | InChI=1S/C28H44N2O5S/c1-16(10-11-20-15-29-19(4)36-20)21-13-23-28(7,35-23)12-8-9-17(2)25(33)18(3)26(34)27(5,6)22(31)14-24(32)30-21/h10-11,17-18,21-23,25,31,33H,8-9,12-15H2,1-7H3,(H,30,32)/t17-,18+,21-,22-,23-,25-,28+/m0/s1 |
| InChIKey | RMBZIDSGTIRCGA-MDNXJZBHSA-N |
| XLogP | 4.18 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|