C27H43NO4S — CID 163685523
(10R,11S)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-[(2R)-2-methyl-2,3-dihydrothiophen-4-yl]prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 163685523) has the molecular formula C27H43NO4S and a molecular weight of 477.71 g/mol. Its IUPAC name is (10R,11S)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-[(2R)-2-methyl-2,3-dihydrothiophen-4-yl]prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (10R,11S)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-[(2R)-2-methyl-2,3-dihydrothiophen-4-yl]prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 163685523 |
| Molecular Formula | C27H43NO4S |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | (10R,11S)-11-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-[(2R)-2-methyl-2,3-dihydrothiophen-4-yl]prop-1-en-2-yl]-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\C1=CS[C@H](C)C1)C1CC2OC2CCCC(C)[C@H](O)[C@@H](C)C(=O)C(C)(C)CCC(=O)N1 |
| InChI | InChI=1S/C27H43NO4S/c1-16-8-7-9-22-23(32-22)14-21(17(2)12-20-13-18(3)33-15-20)28-24(29)10-11-27(5,6)26(31)19(4)25(16)30/h12,15-16,18-19,21-23,25,30H,7-11,13-14H2,1-6H3,(H,28,29)/b17-12+/t16?,18-,19-,21?,22?,23?,25+/m1/s1 |
| InChIKey | JONPEFQXNBWEHH-NRWAJCSQSA-N |
| XLogP | 5.18 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|