C20H33NO4 — CID 142177233
(4S,7R,8S,9S,11E,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142177233) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is (4S,7R,8S,9S,11E,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,11E,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142177233 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (4S,7R,8S,9S,11E,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\CCNC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)C\C=C\1 |
| InChI | InChI=1S/C20H33NO4/c1-13-8-6-10-14(2)18(24)15(3)19(25)20(4,5)16(22)12-17(23)21-11-7-9-13/h6,8-9,14-16,18,22,24H,7,10-12H2,1-5H3,(H,21,23)/b8-6+,13-9+/t14-,15+,16-,18-/m0/s1 |
| InChIKey | PUHAAGQSPXKXLA-UVZPYFTFSA-N |
| XLogP | 2.38 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |