C22H35NO3 — CID 123363413
7-hydroxy-8,8,10,12,16-pentamethyl-4-azatricyclo[14.2.0.01,17]octadec-17-ene-5,9-dione (PubChem CID 123363413) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 7-hydroxy-8,8,10,12,16-pentamethyl-4-azatricyclo[14.2.0.01,17]octadec-17-ene-5,9-dione.
| Compound Name | 7-hydroxy-8,8,10,12,16-pentamethyl-4-azatricyclo[14.2.0.01,17]octadec-17-ene-5,9-dione |
|---|---|
| PubChem CID | 123363413 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 7-hydroxy-8,8,10,12,16-pentamethyl-4-azatricyclo[14.2.0.01,17]octadec-17-ene-5,9-dione |
| SMILES | CC1CCCC2(C)C3=CC32CCNC(=O)CC(O)C(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C22H35NO3/c1-14-7-6-8-21(5)16-13-22(16,21)9-10-23-18(25)12-17(24)20(3,4)19(26)15(2)11-14/h13-15,17,24H,6-12H2,1-5H3,(H,23,25) |
| InChIKey | PXWBMHKWRBDNKH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|