C21H35NO3 — CID 142177270
(11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142177270) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142177270 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (11E,13Z)-4-hydroxy-5,5,7,9,13,15-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\C(C)CNC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)C\C=C\1 |
| InChI | InChI=1S/C21H35NO3/c1-14-8-7-9-15(2)11-17(4)20(25)21(5,6)18(23)12-19(24)22-13-16(3)10-14/h7-8,10,15-18,23H,9,11-13H2,1-6H3,(H,22,24)/b8-7+,14-10+ |
| InChIKey | CIOQTKCKQGKWRE-ACLLVWJRSA-N |
| XLogP | 3.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |