C21H35NO4 — CID 142099495
(4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione (PubChem CID 142099495) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is (4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione.
| Compound Name | (4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione |
|---|---|
| PubChem CID | 142099495 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | (4S,9R,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadec-13-ene-2,6,10-trione |
| SMILES | C/C1=C/CCN(C)C(=O)C[C@H](O)C(C)(C)C(=O)C(C)C[C@@H](C)C(=O)CC1 |
| InChI | InChI=1S/C21H35NO4/c1-14-8-7-11-22(6)19(25)13-18(24)21(4,5)20(26)16(3)12-15(2)17(23)10-9-14/h8,15-16,18,24H,7,9-13H2,1-6H3/b14-8-/t15-,16?,18+/m1/s1 |
| InChIKey | HPIPHSOCDKGJTO-AWUINLEFSA-N |
| XLogP | 3.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|