C17H33NO2 — CID 10945964
N,N-diethyl-2-(1-hydroxyethyl)undec-10-enamide (PubChem CID 10945964) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is N,N-diethyl-2-(1-hydroxyethyl)undec-10-enamide.
| Compound Name | N,N-diethyl-2-(1-hydroxyethyl)undec-10-enamide |
|---|---|
| PubChem CID | 10945964 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | N,N-diethyl-2-(1-hydroxyethyl)undec-10-enamide |
| SMILES | C=CCCCCCCCC(C(=O)N(CC)CC)C(C)O |
| InChI | InChI=1S/C17H33NO2/c1-5-8-9-10-11-12-13-14-16(15(4)19)17(20)18(6-2)7-3/h5,15-16,19H,1,6-14H2,2-4H3 |
| InChIKey | DLYKHYSKJQUNFH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|