C22H43NO4 — CID 139887018
(Z)-2-ethyl-12-hydroxy-N,N-bis(hydroxymethyl)octadec-9-enamide (PubChem CID 139887018) has the molecular formula C22H43NO4 and a molecular weight of 385.59 g/mol. Its IUPAC name is (Z)-2-ethyl-12-hydroxy-N,N-bis(hydroxymethyl)octadec-9-enamide.
| Compound Name | (Z)-2-ethyl-12-hydroxy-N,N-bis(hydroxymethyl)octadec-9-enamide |
|---|---|
| PubChem CID | 139887018 |
| Molecular Formula | C22H43NO4 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | (Z)-2-ethyl-12-hydroxy-N,N-bis(hydroxymethyl)octadec-9-enamide |
| SMILES | CCCCCCC(O)C/C=C\CCCCCCC(CC)C(=O)N(CO)CO |
| InChI | InChI=1S/C22H43NO4/c1-3-5-6-13-16-21(26)17-14-11-9-7-8-10-12-15-20(4-2)22(27)23(18-24)19-25/h11,14,20-21,24-26H,3-10,12-13,15-19H2,1-2H3/b14-11- |
| InChIKey | APCRILPKNHUODV-KAMYIIQDSA-N |
| XLogP | 4.36 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|