C14H27NO2 — CID 14815154
2-(1-hydroxyprop-2-enyl)-N,N,2-trimethyloctanamide (PubChem CID 14815154) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-(1-hydroxyprop-2-enyl)-N,N,2-trimethyloctanamide.
| Compound Name | 2-(1-hydroxyprop-2-enyl)-N,N,2-trimethyloctanamide |
|---|---|
| PubChem CID | 14815154 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2-(1-hydroxyprop-2-enyl)-N,N,2-trimethyloctanamide |
| SMILES | C=CC(O)C(C)(CCCCCC)C(=O)N(C)C |
| InChI | InChI=1S/C14H27NO2/c1-6-8-9-10-11-14(3,12(16)7-2)13(17)15(4)5/h7,12,16H,2,6,8-11H2,1,3-5H3 |
| InChIKey | CBEZABZGVUYCNM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|