C22H43NO2 — CID 174990440
(Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide (PubChem CID 174990440) has the molecular formula C22H43NO2 and a molecular weight of 353.59 g/mol. Its IUPAC name is (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide.
| Compound Name | (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide |
|---|---|
| PubChem CID | 174990440 |
| Molecular Formula | C22H43NO2 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | (Z)-2-(1-hydroxyethyl)-N,N-dimethyloctadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C(=O)N(C)C)C(C)O |
| InChI | InChI=1S/C22H43NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(20(2)24)22(25)23(3)4/h12-13,20-21,24H,5-11,14-19H2,1-4H3/b13-12- |
| InChIKey | MEEOTLRWFHNVMY-SEYXRHQNSA-N |
| XLogP | 5.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|