C16H31NO2 — CID 71474838
(5R,7R)-7-hydroxy-N,5,8,8-tetramethyl-N-prop-2-enylnonanamide (PubChem CID 71474838) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (5R,7R)-7-hydroxy-N,5,8,8-tetramethyl-N-prop-2-enylnonanamide.
| Compound Name | (5R,7R)-7-hydroxy-N,5,8,8-tetramethyl-N-prop-2-enylnonanamide |
|---|---|
| PubChem CID | 71474838 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (5R,7R)-7-hydroxy-N,5,8,8-tetramethyl-N-prop-2-enylnonanamide |
| SMILES | C=CCN(C)C(=O)CCC[C@@H](C)C[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-7-11-17(6)15(19)10-8-9-13(2)12-14(18)16(3,4)5/h7,13-14,18H,1,8-12H2,2-6H3/t13-,14-/m1/s1 |
| InChIKey | UKJOGFLXEQPDEG-ZIAGYGMSSA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|