C19H35AcNO2 — CID 59084203
actinium;(2S)-2-[(2R)-1-hydroxy-2-methylpent-4-enyl]-1-methyl-azacyclotridecan-3-one (PubChem CID 59084203) has the molecular formula C19H35AcNO2 and a molecular weight of 536.49 g/mol. Its IUPAC name is actinium;(2S)-2-[(2R)-1-hydroxy-2-methylpent-4-enyl]-1-methyl-azacyclotridecan-3-one.
| Compound Name | actinium;(2S)-2-[(2R)-1-hydroxy-2-methylpent-4-enyl]-1-methyl-azacyclotridecan-3-one |
|---|---|
| PubChem CID | 59084203 |
| Molecular Formula | C19H35AcNO2 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | actinium;(2S)-2-[(2R)-1-hydroxy-2-methylpent-4-enyl]-1-methyl-azacyclotridecan-3-one |
| SMILES | C=CC[C@@H](C)C(O)[C@H]1C(=O)CCCCCCCCCCN1C.[Ac] |
| InChI | InChI=1S/C19H35NO2.Ac/c1-4-13-16(2)19(22)18-17(21)14-11-9-7-5-6-8-10-12-15-20(18)3;/h4,16,18-19,22H,1,5-15H2,2-3H3;/t16-,18-,19?;/m1./s1 |
| InChIKey | QIJJVPGPQZIOJU-ZJEDDQRESA-N |
| XLogP | 3.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|