C14H25NO2 — CID 58333053
(2S)-2-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-1-methylpiperidin-3-one (PubChem CID 58333053) has the molecular formula C14H25NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (2S)-2-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-1-methylpiperidin-3-one.
| Compound Name | (2S)-2-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-1-methylpiperidin-3-one |
|---|---|
| PubChem CID | 58333053 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (2S)-2-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-1-methylpiperidin-3-one |
| SMILES | [2H]C([2H])C/C=C/C[C@@H](C)C(O)[C@H]1C(=O)CCCN1C |
| InChI | InChI=1S/C14H25NO2/c1-4-5-6-8-11(2)14(17)13-12(16)9-7-10-15(13)3/h5-6,11,13-14,17H,4,7-10H2,1-3H3/b6-5+/t11-,13-,14?/m1/s1/i1D2 |
| InChIKey | BLLFJFUIYAAUKS-RYVKIQOXSA-N |
| XLogP | 2.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|