C19H36N2O3 — CID 58003074
(E)-6-hydroxy-7-methyl-5-(methylamino)-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]undec-9-en-4-one (PubChem CID 58003074) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is (E)-6-hydroxy-7-methyl-5-(methylamino)-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]undec-9-en-4-one.
| Compound Name | (E)-6-hydroxy-7-methyl-5-(methylamino)-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]undec-9-en-4-one |
|---|---|
| PubChem CID | 58003074 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | (E)-6-hydroxy-7-methyl-5-(methylamino)-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]undec-9-en-4-one |
| SMILES | C/C=C/CC(C)C(O)C(NC)C(=O)CCCN[C@@H](C(C)=O)C(C)C |
| InChI | InChI=1S/C19H36N2O3/c1-7-8-10-14(4)19(24)18(20-6)16(23)11-9-12-21-17(13(2)3)15(5)22/h7-8,13-14,17-21,24H,9-12H2,1-6H3/b8-7+/t14?,17-,18?,19?/m1/s1 |
| InChIKey | ANPLFBKKFBAUDP-KHQOBABDSA-N |
| XLogP | 2.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|