C18H35Ac2NO3 — CID 20675840
actinium;(E)-4-[tert-butyl(methyl)amino]-5,10-dihydroxy-2,2,6-trimethyldec-8-en-3-one (PubChem CID 20675840) has the molecular formula C18H35Ac2NO3 and a molecular weight of 767.48 g/mol. Its IUPAC name is actinium;(E)-4-[tert-butyl(methyl)amino]-5,10-dihydroxy-2,2,6-trimethyldec-8-en-3-one.
| Compound Name | actinium;(E)-4-[tert-butyl(methyl)amino]-5,10-dihydroxy-2,2,6-trimethyldec-8-en-3-one |
|---|---|
| PubChem CID | 20675840 |
| Molecular Formula | C18H35Ac2NO3 |
| Molecular Weight | 767.48 g/mol |
| Exact Mass | 767.32 |
| IUPAC Name | actinium;(E)-4-[tert-butyl(methyl)amino]-5,10-dihydroxy-2,2,6-trimethyldec-8-en-3-one |
| SMILES | CC(C/C=C/CO)C(O)C(C(=O)C(C)(C)C)N(C)C(C)(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C18H35NO3.2Ac/c1-13(11-9-10-12-20)15(21)14(16(22)17(2,3)4)19(8)18(5,6)7;;/h9-10,13-15,20-21H,11-12H2,1-8H3;;/b10-9+;; |
| InChIKey | OBLPINHVRDJYNL-TTWKNDKESA-N |
| XLogP | 2.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|