C18H34AcBrNO2 — CID 20675841
actinium;(E)-10-bromo-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one (PubChem CID 20675841) has the molecular formula C18H34AcBrNO2 and a molecular weight of 603.38 g/mol. Its IUPAC name is actinium;(E)-10-bromo-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one.
| Compound Name | actinium;(E)-10-bromo-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one |
|---|---|
| PubChem CID | 20675841 |
| Molecular Formula | C18H34AcBrNO2 |
| Molecular Weight | 603.38 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | actinium;(E)-10-bromo-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one |
| SMILES | CC(C/C=C/CBr)C(O)C(C(=O)C(C)(C)C)N(C)C(C)(C)C.[Ac] |
| InChI | InChI=1S/C18H34BrNO2.Ac/c1-13(11-9-10-12-19)15(21)14(16(22)17(2,3)4)20(8)18(5,6)7;/h9-10,13-15,21H,11-12H2,1-8H3;/b10-9+; |
| InChIKey | OQEMHELKFDELIK-RRABGKBLSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|