C22H39NO2 — CID 59084178
(2S)-1-methyl-2-[(2R,4E,6E)-8,8,8-trideuterio-1-hydroxy-2-methylocta-4,6-dienyl]-azacyclotridecan-3-one (PubChem CID 59084178) has the molecular formula C22H39NO2 and a molecular weight of 352.58 g/mol. Its IUPAC name is (2S)-1-methyl-2-[(2R,4E,6E)-8,8,8-trideuterio-1-hydroxy-2-methylocta-4,6-dienyl]-azacyclotridecan-3-one.
| Compound Name | (2S)-1-methyl-2-[(2R,4E,6E)-8,8,8-trideuterio-1-hydroxy-2-methylocta-4,6-dienyl]-azacyclotridecan-3-one |
|---|---|
| PubChem CID | 59084178 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.32 |
| IUPAC Name | (2S)-1-methyl-2-[(2R,4E,6E)-8,8,8-trideuterio-1-hydroxy-2-methylocta-4,6-dienyl]-azacyclotridecan-3-one |
| SMILES | [2H]C([2H])([2H])/C=C/C=C/C[C@@H](C)C(O)[C@H]1C(=O)CCCCCCCCCCN1C |
| InChI | InChI=1S/C22H39NO2/c1-4-5-6-13-16-19(2)22(25)21-20(24)17-14-11-9-7-8-10-12-15-18-23(21)3/h4-6,13,19,21-22,25H,7-12,14-18H2,1-3H3/b5-4+,13-6+/t19-,21-,22?/m1/s1/i1D3 |
| InChIKey | BCWOXFBTGWDZLB-BKCRPQSKSA-N |
| XLogP | 4.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|