C18H35AcNO2 — CID 20675799
actinium;(E)-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one (PubChem CID 20675799) has the molecular formula C18H35AcNO2 and a molecular weight of 524.48 g/mol. Its IUPAC name is actinium;(E)-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one.
| Compound Name | actinium;(E)-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one |
|---|---|
| PubChem CID | 20675799 |
| Molecular Formula | C18H35AcNO2 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | actinium;(E)-4-[tert-butyl(methyl)amino]-5-hydroxy-2,2,6-trimethyldec-8-en-3-one |
| SMILES | C/C=C/CC(C)C(O)C(C(=O)C(C)(C)C)N(C)C(C)(C)C.[Ac] |
| InChI | InChI=1S/C18H35NO2.Ac/c1-10-11-12-13(2)15(20)14(16(21)17(3,4)5)19(9)18(6,7)8;/h10-11,13-15,20H,12H2,1-9H3;/b11-10+; |
| InChIKey | RIMZIUHSRVCUIN-ASTDGNLGSA-N |
| XLogP | 3.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|