C16H31NO2 — CID 58604717
(E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one (PubChem CID 58604717) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one.
| Compound Name | (E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one |
|---|---|
| PubChem CID | 58604717 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@@H](C(=O)C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C16H31NO2/c1-8-9-10-13(6)16(19)14(15(18)11(2)3)17(7)12(4)5/h8-9,11-14,16,19H,10H2,1-7H3/b9-8+/t13-,14-,16-/m1/s1 |
| InChIKey | DDXKEBLWYMFMIS-MXGUUFQVSA-N |
| XLogP | 2.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|