C21H37NO2 — CID 59084179
(2S)-2-[(2R,4E)-7,7-dideuterio-1-hydroxy-2-methylhepta-4,6-dienyl]-1-methyl-azacyclotridecan-3-one (PubChem CID 59084179) has the molecular formula C21H37NO2 and a molecular weight of 337.54 g/mol. Its IUPAC name is (2S)-2-[(2R,4E)-7,7-dideuterio-1-hydroxy-2-methylhepta-4,6-dienyl]-1-methyl-azacyclotridecan-3-one.
| Compound Name | (2S)-2-[(2R,4E)-7,7-dideuterio-1-hydroxy-2-methylhepta-4,6-dienyl]-1-methyl-azacyclotridecan-3-one |
|---|---|
| PubChem CID | 59084179 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.29 |
| IUPAC Name | (2S)-2-[(2R,4E)-7,7-dideuterio-1-hydroxy-2-methylhepta-4,6-dienyl]-1-methyl-azacyclotridecan-3-one |
| SMILES | [2H]C([2H])=C/C=C/C[C@@H](C)C(O)[C@H]1C(=O)CCCCCCCCCCN1C |
| InChI | InChI=1S/C21H37NO2/c1-4-5-12-15-18(2)21(24)20-19(23)16-13-10-8-6-7-9-11-14-17-22(20)3/h4-5,12,18,20-21,24H,1,6-11,13-17H2,2-3H3/b12-5+/t18-,20-,21?/m1/s1/i1D2 |
| InChIKey | YHXVFWHABZZOJV-KXERAQRRSA-N |
| XLogP | 4.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|