C20H37NO2 — CID 59084177
(2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one (PubChem CID 59084177) has the molecular formula C20H37NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is (2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one.
| Compound Name | (2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one |
|---|---|
| PubChem CID | 59084177 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | (2S)-1-methyl-2-[(E,2R)-5,6,6,6-tetradeuterio-1-hydroxy-2-methylhex-4-enyl]-azacyclotridecan-3-one |
| SMILES | [2H]/C(=C\C[C@@H](C)C(O)[C@H]1C(=O)CCCCCCCCCCN1C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H37NO2/c1-4-5-14-17(2)20(23)19-18(22)15-12-10-8-6-7-9-11-13-16-21(19)3/h4-5,17,19-20,23H,6-16H2,1-3H3/b5-4+/t17-,19-,20?/m1/s1/i1D3,4D |
| InChIKey | OHFQBURKPJNASE-GPKUJSIKSA-N |
| XLogP | 4.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|