C25H48NO3+ — CID 90746118
(3-carboxy-2-hydroxyhenicosa-12,15-dienyl)-trimethylazanium (PubChem CID 90746118) has the molecular formula C25H48NO3+ and a molecular weight of 410.66 g/mol. Its IUPAC name is (3-carboxy-2-hydroxyhenicosa-12,15-dienyl)-trimethylazanium.
| Compound Name | (3-carboxy-2-hydroxyhenicosa-12,15-dienyl)-trimethylazanium |
|---|---|
| PubChem CID | 90746118 |
| Molecular Formula | C25H48NO3+ |
| Molecular Weight | 410.66 g/mol |
| Exact Mass | 410.36 |
| IUPAC Name | (3-carboxy-2-hydroxyhenicosa-12,15-dienyl)-trimethylazanium |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(C(=O)O)C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C25H47NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25(28)29)24(27)22-26(2,3)4/h9-10,12-13,23-24,27H,5-8,11,14-22H2,1-4H3/p+1 |
| InChIKey | KOTDCXOCGBMDNH-UHFFFAOYSA-O |
| XLogP | 5.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|