C16H30NO2Y- — CID 58604716
(E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one;yttrium (PubChem CID 58604716) has the molecular formula C16H30NO2Y- and a molecular weight of 357.33 g/mol. Its IUPAC name is (E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one;yttrium.
| Compound Name | (E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one;yttrium |
|---|---|
| PubChem CID | 58604716 |
| Molecular Formula | C16H30NO2Y- |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (E,4S,5R,6R)-5-hydroxy-2,6-dimethyl-4-[methyl(propan-2-yl)amino]dec-8-en-3-one;yttrium |
| SMILES | [CH2-]/C=C/C[C@@H](C)[C@@H](O)[C@@H](C(=O)C(C)C)N(C)C(C)C.[Y] |
| InChI | InChI=1S/C16H30NO2.Y/c1-8-9-10-13(6)16(19)14(15(18)11(2)3)17(7)12(4)5;/h8-9,11-14,16,19H,1,10H2,2-7H3;/q-1;/b9-8+;/t13-,14-,16-;/m1./s1 |
| InChIKey | ORYQGEDNWBUTAV-NXCHBDRQSA-N |
| XLogP | 2.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|