C17H31NO2 — CID 58590067
2-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methylazecan-3-one (PubChem CID 58590067) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methylazecan-3-one.
| Compound Name | 2-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methylazecan-3-one |
|---|---|
| PubChem CID | 58590067 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 2-[(E,1R,2R)-1-hydroxy-2-methylhex-4-enyl]-1-methylazecan-3-one |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)C1C(=O)CCCCCCCN1C |
| InChI | InChI=1S/C17H31NO2/c1-4-5-11-14(2)17(20)16-15(19)12-9-7-6-8-10-13-18(16)3/h4-5,14,16-17,20H,6-13H2,1-3H3/b5-4+/t14-,16?,17-/m1/s1 |
| InChIKey | AKTMNAGGLRUORM-ISIKGWIBSA-N |
| XLogP | 3.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|