C15H27NO2 — CID 58333044
(2S)-1-methyl-2-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]piperidin-3-one (PubChem CID 58333044) has the molecular formula C15H27NO2 and a molecular weight of 256.40 g/mol. Its IUPAC name is (2S)-1-methyl-2-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]piperidin-3-one.
| Compound Name | (2S)-1-methyl-2-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]piperidin-3-one |
|---|---|
| PubChem CID | 58333044 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | (2S)-1-methyl-2-[(E,2R)-8,8,8-trideuterio-1-hydroxy-2-methyloct-4-enyl]piperidin-3-one |
| SMILES | [2H]C([2H])([2H])CC/C=C/C[C@@H](C)C(O)[C@H]1C(=O)CCCN1C |
| InChI | InChI=1S/C15H27NO2/c1-4-5-6-7-9-12(2)15(18)14-13(17)10-8-11-16(14)3/h6-7,12,14-15,18H,4-5,8-11H2,1-3H3/b7-6+/t12-,14-,15?/m1/s1/i1D3 |
| InChIKey | KULHMIZXNWKECW-ZUFKSGFFSA-N |
| XLogP | 2.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|