C19H35N2O3- — CID 58003073
[(E)-6-hydroxy-7-methyl-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]-4-oxoundec-9-en-5-yl]-methylazanide (PubChem CID 58003073) has the molecular formula C19H35N2O3- and a molecular weight of 339.50 g/mol. Its IUPAC name is [(E)-6-hydroxy-7-methyl-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]-4-oxoundec-9-en-5-yl]-methylazanide.
| Compound Name | [(E)-6-hydroxy-7-methyl-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]-4-oxoundec-9-en-5-yl]-methylazanide |
|---|---|
| PubChem CID | 58003073 |
| Molecular Formula | C19H35N2O3- |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | [(E)-6-hydroxy-7-methyl-1-[[(3R)-2-methyl-4-oxopentan-3-yl]amino]-4-oxoundec-9-en-5-yl]-methylazanide |
| SMILES | C/C=C/CC(C)C(O)C([N-]C)C(=O)CCCN[C@@H](C(C)=O)C(C)C |
| InChI | InChI=1S/C19H35N2O3/c1-7-8-10-14(4)19(24)18(20-6)16(23)11-9-12-21-17(13(2)3)15(5)22/h7-8,13-14,17-19,21,24H,9-12H2,1-6H3/q-1/b8-7+/t14?,17-,18?,19?/m1/s1 |
| InChIKey | RNWHCMVVVPFAOI-KHQOBABDSA-N |
| XLogP | 2.87 |
| TPSA | 80.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|