C21H35NO3 — CID 142177252
(4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione (PubChem CID 142177252) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione.
| Compound Name | (4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
|---|---|
| PubChem CID | 142177252 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (4S,11E,13Z)-4-hydroxy-1,5,5,7,9,13-hexamethyl-1-azacyclohexadeca-11,13-diene-2,6-dione |
| SMILES | CC1=C\CCN(C)C(=O)C[C@H](O)C(C)(C)C(=O)C(C)CC(C)C\C=C\1 |
| InChI | InChI=1S/C21H35NO3/c1-15-9-7-10-16(2)13-17(3)20(25)21(4,5)18(23)14-19(24)22(6)12-8-11-15/h7,9,11,16-18,23H,8,10,12-14H2,1-6H3/b9-7+,15-11+/t16?,17?,18-/m0/s1 |
| InChIKey | DRIYZRCAYNVNDV-OBKNBZAZSA-N |
| XLogP | 3.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |