C29H47NO3S — CID 142247857
(8R,9Z)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadec-9-ene-1,5-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole (PubChem CID 142247857) has the molecular formula C29H47NO3S and a molecular weight of 489.77 g/mol. Its IUPAC name is (8R,9Z)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadec-9-ene-1,5-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole.
| Compound Name | (8R,9Z)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadec-9-ene-1,5-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole |
|---|---|
| PubChem CID | 142247857 |
| Molecular Formula | C29H47NO3S |
| Molecular Weight | 489.77 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | (8R,9Z)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadec-9-ene-1,5-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole |
| SMILES | C/C1=C/[C@H](C)CCC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)CCC1.C/C=C\c1csc(C)n1 |
| InChI | InChI=1S/C22H38O3.C7H9NS/c1-15-8-7-9-16(2)13-18(4)21(25)22(5,6)20(24)14-19(23)11-10-17(3)12-15;1-3-4-7-5-9-6(2)8-7/h12,16-18,20,24H,7-11,13-14H2,1-6H3;3-5H,1-2H3/b15-12-;4-3-/t16?,17-,18?,20?;/m1./s1 |
| InChIKey | MSRGMJFCFSMEAP-ADYIZFTGSA-N |
| XLogP | 7.60 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.77 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|