C28H45NO4S — CID 142099491
(13Z)-13-ethyl-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole (PubChem CID 142099491) has the molecular formula C28H45NO4S and a molecular weight of 491.74 g/mol. Its IUPAC name is (13Z)-13-ethyl-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole.
| Compound Name | (13Z)-13-ethyl-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole |
|---|---|
| PubChem CID | 142099491 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | (13Z)-13-ethyl-4-hydroxy-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione;2-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole |
| SMILES | C/C=C\c1csc(C)n1.CC/C1=C/CCOC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)CCC1 |
| InChI | InChI=1S/C21H36O4.C7H9NS/c1-6-17-10-7-9-15(2)13-16(3)20(24)21(4,5)18(22)14-19(23)25-12-8-11-17;1-3-4-7-5-9-6(2)8-7/h11,15-16,18,22H,6-10,12-14H2,1-5H3;3-5H,1-2H3/b17-11-;4-3- |
| InChIKey | NJPWWXGSFBZHNM-QCTRZABKSA-N |
| XLogP | 6.93 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|