C26H41NO6S — CID 46866031
(4S,7R,8S,9S,16S,17Z)-4,8,16-trihydroxy-5,5,7,9-tetramethyl-17-[(2-methyl-1,3-thiazol-4-yl)methylidene]-oxacyclooctadecane-2,6-dione (PubChem CID 46866031) has the molecular formula C26H41NO6S and a molecular weight of 495.68 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S,17Z)-4,8,16-trihydroxy-5,5,7,9-tetramethyl-17-[(2-methyl-1,3-thiazol-4-yl)methylidene]-oxacyclooctadecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S,17Z)-4,8,16-trihydroxy-5,5,7,9-tetramethyl-17-[(2-methyl-1,3-thiazol-4-yl)methylidene]-oxacyclooctadecane-2,6-dione |
|---|---|
| PubChem CID | 46866031 |
| Molecular Formula | C26H41NO6S |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (4S,7R,8S,9S,16S,17Z)-4,8,16-trihydroxy-5,5,7,9-tetramethyl-17-[(2-methyl-1,3-thiazol-4-yl)methylidene]-oxacyclooctadecane-2,6-dione |
| SMILES | Cc1nc(/C=C2/COC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCCCCC[C@@H]2O)cs1 |
| InChI | InChI=1S/C26H41NO6S/c1-16-10-8-6-7-9-11-21(28)19(12-20-15-34-18(3)27-20)14-33-23(30)13-22(29)26(4,5)25(32)17(2)24(16)31/h12,15-17,21-22,24,28-29,31H,6-11,13-14H2,1-5H3/b19-12-/t16-,17+,21-,22-,24-/m0/s1 |
| InChIKey | HABBVGQJNXNSIO-IYNHZCLDSA-N |
| XLogP | 4.07 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |