C20H34O5 — CID 15970134
(4S,7R,8R,9S,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 15970134) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (4S,7R,8R,9S,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8R,9S,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 15970134 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (4S,7R,8R,9S,13Z)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/CCOC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H](O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C20H34O5/c1-13-8-6-10-14(2)18(23)15(3)19(24)20(4,5)16(21)12-17(22)25-11-7-9-13/h9,14-16,18,21,23H,6-8,10-12H2,1-5H3/b13-9-/t14-,15+,16-,18+/m0/s1 |
| InChIKey | SJYCUXYGZXPEOF-PZGWLIRTSA-N |
| XLogP | 3.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|