C27H39NO5 — CID 91299345
(8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-pyridin-4-ylethenyl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 91299345) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is (8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-pyridin-4-ylethenyl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-pyridin-4-ylethenyl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 91299345 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (8S,9S,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-(2-pyridin-4-ylethenyl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC1=CC[C@@H](C=Cc2ccncc2)OC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C27H39NO5/c1-18-7-6-8-19(2)25(31)20(3)26(32)27(4,5)23(29)17-24(30)33-22(11-9-18)12-10-21-13-15-28-16-14-21/h9-10,12-16,19-20,22-23,25,29,31H,6-8,11,17H2,1-5H3/t19-,20?,22-,23?,25-/m0/s1 |
| InChIKey | ZMDMAUCAPBFEOH-PJDQOTEGSA-N |
| XLogP | 4.51 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|