C22H38O3 — CID 58582981
(4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9,13-heptamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 58582981) has the molecular formula C22H38O3 and a molecular weight of 351.55 g/mol. Its IUPAC name is (4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9,13-heptamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9,13-heptamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 58582981 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 351.55 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (4S,7R,8S,9R,13Z)-16-deuterio-4,5,5,7,8,9,13-heptamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | [2H]C1C/C=C(/C)CCC[C@@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)O1 |
| InChI | InChI=1S/C22H38O3/c1-15-10-8-12-16(2)18(4)19(5)21(24)22(6,7)17(3)14-20(23)25-13-9-11-15/h11,16-19H,8-10,12-14H2,1-7H3/b15-11-/t16-,17+,18+,19-/m1/s1/i13D/t13?,16-,17+,18+,19- |
| InChIKey | BHMDQPPPYGIZOD-SAAGBVJTSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|