C34H57NO4SSi — CID 71127676
(4S,7S,8R,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 71127676) has the molecular formula C34H57NO4SSi and a molecular weight of 603.99 g/mol. Its IUPAC name is (4S,7S,8R,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7S,8R,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 71127676 |
| Molecular Formula | C34H57NO4SSi |
| Molecular Weight | 603.99 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | (4S,7S,8R,9S,13Z,16S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5,7,8,9,13-hexamethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@@H](C)[C@H](C)[C@@H](C)CCC1 |
| InChI | InChI=1S/C34H57NO4SSi/c1-22-15-14-16-23(2)25(4)26(5)32(37)34(10,11)30(39-41(12,13)33(7,8)9)20-31(36)38-29(18-17-22)24(3)19-28-21-40-27(6)35-28/h17,19,21,23,25-26,29-30H,14-16,18,20H2,1-13H3/b22-17-,24-19+/t23-,25+,26-,29-,30-/m0/s1 |
| InChIKey | SLXHUGNNTAEBCB-BYQBAEKUSA-N |
| XLogP | 9.57 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.99 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|