C39H69NO5SSi2 — CID 91519371
(4S,7R,8S,9S,16S)-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 91519371) has the molecular formula C39H69NO5SSi2 and a molecular weight of 720.22 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,16S)-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 91519371 |
| Molecular Formula | C39H69NO5SSi2 |
| Molecular Weight | 720.22 g/mol |
| Exact Mass | 719.44 |
| IUPAC Name | (4S,7R,8S,9S,16S)-5,5,7,9,13-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)CCCC(C)=CC[C@@H](C(C)=Cc2csc(C)n2)OC(=O)C[C@H](O[Si](CC)(CC)CC)C(C)(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C39H69NO5SSi2/c1-14-47(15-2,16-3)44-35-26-36(41)43-34(30(9)25-33-27-46-32(11)40-33)24-23-28(7)21-20-22-29(8)37(31(10)38(42)39(35,12)13)45-48(17-4,18-5)19-6/h23,25,27,29,31,34-35,37H,14-22,24,26H2,1-13H3/t29-,31+,34-,35-,37-/m0/s1 |
| InChIKey | CAUVKHJFPOWJGU-KLZRPAIPSA-N |
| XLogP | 11.33 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.22 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|