C38H66BrNO6SSi2 — CID 91606308
(4S,7S,8R,9R,14S,16R)-14-bromo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6,13-trione (PubChem CID 91606308) has the molecular formula C38H66BrNO6SSi2 and a molecular weight of 801.09 g/mol. Its IUPAC name is (4S,7S,8R,9R,14S,16R)-14-bromo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6,13-trione.
| Compound Name | (4S,7S,8R,9R,14S,16R)-14-bromo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6,13-trione |
|---|---|
| PubChem CID | 91606308 |
| Molecular Formula | C38H66BrNO6SSi2 |
| Molecular Weight | 801.09 g/mol |
| Exact Mass | 799.33 |
| IUPAC Name | (4S,7S,8R,9R,14S,16R)-14-bromo-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,8-bis(triethylsilyloxy)-oxacyclohexadecane-2,6,13-trione |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](C)CCCC(=O)[C@@H](Br)C[C@H](C(C)=Cc2csc(C)n2)OC(=O)C[C@H](O[Si](CC)(CC)CC)C(C)(C)C(=O)[C@H]1C |
| InChI | InChI=1S/C38H66BrNO6SSi2/c1-13-48(14-2,15-3)45-34-24-35(42)44-33(27(8)22-30-25-47-29(10)40-30)23-31(39)32(41)21-19-20-26(7)36(28(9)37(43)38(34,11)12)46-49(16-4,17-5)18-6/h22,25-26,28,31,33-34,36H,13-21,23-24H2,1-12H3/t26-,28+,31+,33-,34+,36-/m1/s1 |
| InChIKey | XRIRRWSSIOVEKX-BKFYYUPYSA-N |
| XLogP | 10.71 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.09 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|