C33H59NO3 — CID 142247810
(8R)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadecane-1,5-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole;propane (PubChem CID 142247810) has the molecular formula C33H59NO3 and a molecular weight of 517.84 g/mol. Its IUPAC name is (8R)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadecane-1,5-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole;propane.
| Compound Name | (8R)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadecane-1,5-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole;propane |
|---|---|
| PubChem CID | 142247810 |
| Molecular Formula | C33H59NO3 |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.45 |
| IUPAC Name | (8R)-3-hydroxy-2,2,8,10,14,16-hexamethylcyclohexadecane-1,5-dione;2-methyl-5-[(Z)-prop-1-enyl]-3H-pyrrole;propane |
| SMILES | C/C=C\C1=CCC(C)=N1.CC1CCCC(C)C[C@H](C)CCC(=O)CC(O)C(C)(C)C(=O)C(C)C1.CCC |
| InChI | InChI=1S/C22H40O3.C8H11N.C3H8/c1-15-8-7-9-16(2)13-18(4)21(25)22(5,6)20(24)14-19(23)11-10-17(3)12-15;1-3-4-8-6-5-7(2)9-8;1-3-2/h15-18,20,24H,7-14H2,1-6H3;3-4,6H,5H2,1-2H3;3H2,1-2H3/b;4-3-;/t15?,16?,17-,18?,20?;;/m1../s1 |
| InChIKey | FIGCQJAIZQCOQI-QZXBPFNLSA-N |
| XLogP | 8.92 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |