C31H54N3O5PS — CID 163482703
2-aminoethyl-N-[[4-[(E)-2-[(5R,9R,11S)-14-hydroxy-5,9,11,13,13,16-hexamethyl-4-methylidene-12-oxo-oxacyclohexadec-2-yl]prop-1-enyl]-1,3-thiazol-2-yl]methyl]phosphonamidic acid (PubChem CID 163482703) has the molecular formula C31H54N3O5PS and a molecular weight of 611.83 g/mol. Its IUPAC name is 2-aminoethyl-N-[[4-[(E)-2-[(5R,9R,11S)-14-hydroxy-5,9,11,13,13,16-hexamethyl-4-methylidene-12-oxo-oxacyclohexadec-2-yl]prop-1-enyl]-1,3-thiazol-2-yl]methyl]phosphonamidic acid.
| Compound Name | 2-aminoethyl-N-[[4-[(E)-2-[(5R,9R,11S)-14-hydroxy-5,9,11,13,13,16-hexamethyl-4-methylidene-12-oxo-oxacyclohexadec-2-yl]prop-1-enyl]-1,3-thiazol-2-yl]methyl]phosphonamidic acid |
|---|---|
| PubChem CID | 163482703 |
| Molecular Formula | C31H54N3O5PS |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 2-aminoethyl-N-[[4-[(E)-2-[(5R,9R,11S)-14-hydroxy-5,9,11,13,13,16-hexamethyl-4-methylidene-12-oxo-oxacyclohexadec-2-yl]prop-1-enyl]-1,3-thiazol-2-yl]methyl]phosphonamidic acid |
| SMILES | C=C1CC(/C(C)=C/c2csc(CNP(=O)(O)CCN)n2)OC(C)CC(O)C(C)(C)C(=O)[C@@H](C)C[C@H](C)CCC[C@H]1C |
| InChI | InChI=1S/C31H54N3O5PS/c1-20-10-9-11-21(2)22(3)16-27(39-25(6)17-28(35)31(7,8)30(36)24(5)14-20)23(4)15-26-19-41-29(34-26)18-33-40(37,38)13-12-32/h15,19-21,24-25,27-28,35H,3,9-14,16-18,32H2,1-2,4-8H3,(H2,33,37,38)/b23-15+/t20-,21-,24+,25?,27?,28?/m1/s1 |
| InChIKey | CFYJBRJORGUYCZ-ZHHISNHFSA-N |
| XLogP | 6.33 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|